C7H13N3O3 — CID 21355915
(2S)-2-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylic acid (PubChem CID 21355915) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is (2S)-2-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylic acid.
| Compound Name | (2S)-2-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 21355915 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2S)-2-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylic acid |
| SMILES | N/C(=N\O)[C@@H]1CCCCN1C(=O)O |
| InChI | InChI=1S/C7H13N3O3/c8-6(9-13)5-3-1-2-4-10(5)7(11)12/h5,13H,1-4H2,(H2,8,9)(H,11,12)/t5-/m0/s1 |
| InChIKey | BUJUFDDIJDTIPE-YFKPBYRVSA-N |
| XLogP | 0.27 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|