C8H16N4O2 — CID 76944384
1-(N'-hydroxycarbamimidoyl)-N-methylpiperidine-2-carboxamide (PubChem CID 76944384) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(N'-hydroxycarbamimidoyl)-N-methylpiperidine-2-carboxamide.
| Compound Name | 1-(N'-hydroxycarbamimidoyl)-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 76944384 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(N'-hydroxycarbamimidoyl)-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1C(N)=NO |
| InChI | InChI=1S/C8H16N4O2/c1-10-7(13)6-4-2-3-5-12(6)8(9)11-14/h6,14H,2-5H2,1H3,(H2,9,11)(H,10,13) |
| InChIKey | QWNILRWPNLFWTL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|