C8H14N2S — CID 130832702
1-but-3-en-2-yl-3-cyclopropylthiourea (PubChem CID 130832702) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-but-3-en-2-yl-3-cyclopropylthiourea.
| Compound Name | 1-but-3-en-2-yl-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 130832702 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-but-3-en-2-yl-3-cyclopropylthiourea |
| SMILES | C=CC(C)NC(=S)NC1CC1 |
| InChI | InChI=1S/C8H14N2S/c1-3-6(2)9-8(11)10-7-4-5-7/h3,6-7H,1,4-5H2,2H3,(H2,9,10,11) |
| InChIKey | PEBRLUOIGQEPKJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|