C7H9ClO2 — CID 130835086
2-chloro-2-[(2R,3R)-2,3-dimethylcyclopropylidene]acetic acid (PubChem CID 130835086) has the molecular formula C7H9ClO2 and a molecular weight of 160.60 g/mol. Its IUPAC name is 2-chloro-2-[(2R,3R)-2,3-dimethylcyclopropylidene]acetic acid.
| Compound Name | 2-chloro-2-[(2R,3R)-2,3-dimethylcyclopropylidene]acetic acid |
|---|---|
| PubChem CID | 130835086 |
| Molecular Formula | C7H9ClO2 |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 2-chloro-2-[(2R,3R)-2,3-dimethylcyclopropylidene]acetic acid |
| SMILES | C[C@H]1C(=C(Cl)C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C7H9ClO2/c1-3-4(2)5(3)6(8)7(9)10/h3-4H,1-2H3,(H,9,10)/t3-,4-/m1/s1 |
| InChIKey | YFRIEOQEYZPBID-QWWZWVQMSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|