(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride

C6H9ClN2O — CID 59287298

IUPAC(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride
SMILESC[C@H]1NN=C(C(=O)Cl)[C@@H]1C
InChIInChI=1S/C6H9ClN2O/c1-3-4(2)8-9-5(3)6(7)10/h3-4,8H,1-2H3/t3-,4-/m1/s1
InChIKeyJAYBPNGEQLGJPT-QWWZWVQMSA-N
MW160.60 g/mol
LogP0.74
Rot. Bonds1

About (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride

(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride (PubChem CID 59287298) has the molecular formula C6H9ClN2O and a molecular weight of 160.60 g/mol. Its IUPAC name is (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride.

Molecular Properties

Compound Name(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride
PubChem CID59287298
Molecular FormulaC6H9ClN2O
Molecular Weight160.60 g/mol
Exact Mass160.04
IUPAC Name(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride
SMILESC[C@H]1NN=C(C(=O)Cl)[C@@H]1C
InChIInChI=1S/C6H9ClN2O/c1-3-4(2)8-9-5(3)6(7)10/h3-4,8H,1-2H3/t3-,4-/m1/s1
InChIKeyJAYBPNGEQLGJPT-QWWZWVQMSA-N
XLogP0.74
TPSA41.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.60
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride?
The IUPAC name of (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride (CID 59287298) is (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride.
What is the SMILES notation for (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride?
The canonical SMILES for (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride is C[C@H]1NN=C(C(=O)Cl)[C@@H]1C.
What is the InChIKey of (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride?
The InChIKey is JAYBPNGEQLGJPT-QWWZWVQMSA-N. The full InChI is InChI=1S/C6H9ClN2O/c1-3-4(2)8-9-5(3)6(7)10/h3-4,8H,1-2H3/t3-,4-/m1/s1.
What are the key properties of (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride?
(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride has a molecular weight of 160.60 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride is sourced from PubChem (CID 59287298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).