C6H9ClN2O — CID 59287298
(4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride (PubChem CID 59287298) has the molecular formula C6H9ClN2O and a molecular weight of 160.60 g/mol. Its IUPAC name is (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride.
| Compound Name | (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 59287298 |
| Molecular Formula | C6H9ClN2O |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | (4R,5R)-4,5-dimethyl-4,5-dihydro-1H-pyrazole-3-carbonyl chloride |
| SMILES | C[C@H]1NN=C(C(=O)Cl)[C@@H]1C |
| InChI | InChI=1S/C6H9ClN2O/c1-3-4(2)8-9-5(3)6(7)10/h3-4,8H,1-2H3/t3-,4-/m1/s1 |
| InChIKey | JAYBPNGEQLGJPT-QWWZWVQMSA-N |
| XLogP | 0.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|