C9H6BrClN2S — CID 130836009
2-(5-bromo-2-chlorophenyl)-1,3-thiazol-4-amine (PubChem CID 130836009) has the molecular formula C9H6BrClN2S and a molecular weight of 289.59 g/mol. Its IUPAC name is 2-(5-bromo-2-chlorophenyl)-1,3-thiazol-4-amine.
| Compound Name | 2-(5-bromo-2-chlorophenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 130836009 |
| Molecular Formula | C9H6BrClN2S |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 2-(5-bromo-2-chlorophenyl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-c2cc(Br)ccc2Cl)n1 |
| InChI | InChI=1S/C9H6BrClN2S/c10-5-1-2-7(11)6(3-5)9-13-8(12)4-14-9/h1-4H,12H2 |
| InChIKey | RWNBAFLDSIXLBX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |