C9H3Cl2NS — CID 130839787
2,3-dichloro-1-benzothiophene-6-carbonitrile (PubChem CID 130839787) has the molecular formula C9H3Cl2NS and a molecular weight of 228.10 g/mol. Its IUPAC name is 2,3-dichloro-1-benzothiophene-6-carbonitrile.
| Compound Name | 2,3-dichloro-1-benzothiophene-6-carbonitrile |
|---|---|
| PubChem CID | 130839787 |
| Molecular Formula | C9H3Cl2NS |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 226.94 |
| IUPAC Name | 2,3-dichloro-1-benzothiophene-6-carbonitrile |
| SMILES | N#Cc1ccc2c(Cl)c(Cl)sc2c1 |
| InChI | InChI=1S/C9H3Cl2NS/c10-8-6-2-1-5(4-12)3-7(6)13-9(8)11/h1-3H |
| InChIKey | LOLHGVHOJQKMAL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |