C8H4N2OS — CID 23128614
3-oxo-1,2-benzothiazole-6-carbonitrile (PubChem CID 23128614) has the molecular formula C8H4N2OS and a molecular weight of 176.20 g/mol. Its IUPAC name is 3-oxo-1,2-benzothiazole-6-carbonitrile.
| Compound Name | 3-oxo-1,2-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 23128614 |
| Molecular Formula | C8H4N2OS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 3-oxo-1,2-benzothiazole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(=O)[nH]sc2c1 |
| InChI | InChI=1S/C8H4N2OS/c9-4-5-1-2-6-7(3-5)12-10-8(6)11/h1-3H,(H,10,11) |
| InChIKey | GAAOUOZWMKXTIU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |