C12H19N — CID 130841167
1-cyclohex-2-en-1-yl-5-methyl-3,6-dihydro-2H-pyridine (PubChem CID 130841167) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-5-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-cyclohex-2-en-1-yl-5-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 130841167 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-5-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCCN(C2C=CCCC2)C1 |
| InChI | InChI=1S/C12H19N/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12/h3,6-7,12H,2,4-5,8-10H2,1H3 |
| InChIKey | MYDIIJDAAINPEB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|