About 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one
1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one (PubChem CID 130847336) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one |
| PubChem CID | 130847336 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1NCCC[C@H]1O |
| InChI | InChI=1S/C8H15NO2/c1-6(10)5-7-8(11)3-2-4-9-7/h7-9,11H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | DFTRCLQSYLZDEW-JGVFFNPUSA-N |
| XLogP | 0.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one?
The IUPAC name of 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one (CID 130847336) is 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one.
What is the SMILES notation for 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one?
The canonical SMILES for 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one is CC(=O)C[C@@H]1NCCC[C@H]1O.
What is the InChIKey of 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one?
The InChIKey is DFTRCLQSYLZDEW-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(10)5-7-8(11)3-2-4-9-7/h7-9,11H,2-5H2,1H3/t7-,8+/m0/s1.
What are the key properties of 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one?
1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one has a molecular weight of 157.21 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3R)-3-hydroxypiperidin-2-yl]propan-2-one is sourced from PubChem (CID 130847336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).