C12H23NO — CID 130847824
2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-ol (PubChem CID 130847824) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-ol.
| Compound Name | 2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-ol |
|---|---|
| PubChem CID | 130847824 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,4-dimethyl-4-piperidin-1-ylpent-1-en-3-ol |
| SMILES | C=C(C)C(O)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)11(14)12(3,4)13-8-6-5-7-9-13/h11,14H,1,5-9H2,2-4H3 |
| InChIKey | DJPBGFLQRXADHL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|