C12H18N2 — CID 130848876
4-methyl-N-[(2-methylcyclobutyl)methyl]pyridin-2-amine (PubChem CID 130848876) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-methyl-N-[(2-methylcyclobutyl)methyl]pyridin-2-amine.
| Compound Name | 4-methyl-N-[(2-methylcyclobutyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 130848876 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-methyl-N-[(2-methylcyclobutyl)methyl]pyridin-2-amine |
| SMILES | Cc1ccnc(NCC2CCC2C)c1 |
| InChI | InChI=1S/C12H18N2/c1-9-5-6-13-12(7-9)14-8-11-4-3-10(11)2/h5-7,10-11H,3-4,8H2,1-2H3,(H,13,14) |
| InChIKey | UWXODMYUDIRJHL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |