C12H21NO2 — CID 130855505
1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-one (PubChem CID 130855505) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-one.
| Compound Name | 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 130855505 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)butan-2-one |
| SMILES | CCC(=O)CN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C12H21NO2/c1-2-11(14)8-13-6-9-3-4-12(15)5-10(9)7-13/h9-10,12,15H,2-8H2,1H3 |
| InChIKey | YETYPZWNYGSRDL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |