C10H17NO3 — CID 130804528
2-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)acetic acid (PubChem CID 130804528) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)acetic acid.
| Compound Name | 2-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 130804528 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C10H17NO3/c12-9-2-1-7-4-11(6-10(13)14)5-8(7)3-9/h7-9,12H,1-6H2,(H,13,14) |
| InChIKey | BYXHNYSOCOFDOE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |