C9H12F2N2 — CID 130856006
1-(2,6-difluoro-4-methylphenyl)ethylhydrazine (PubChem CID 130856006) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-methylphenyl)ethylhydrazine.
| Compound Name | 1-(2,6-difluoro-4-methylphenyl)ethylhydrazine |
|---|---|
| PubChem CID | 130856006 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(2,6-difluoro-4-methylphenyl)ethylhydrazine |
| SMILES | Cc1cc(F)c(C(C)NN)c(F)c1 |
| InChI | InChI=1S/C9H12F2N2/c1-5-3-7(10)9(6(2)13-12)8(11)4-5/h3-4,6,13H,12H2,1-2H3 |
| InChIKey | QSUOJOZXTWZSJK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|