[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine

C8H9N3S2 — CID 130856141

IUPAC[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine
SMILESNNC(c1ccsc1)c1ccns1
InChIInChI=1S/C8H9N3S2/c9-11-8(6-2-4-12-5-6)7-1-3-10-13-7/h1-5,8,11H,9H2
InChIKeyIKIWTFYOMLLSAM-UHFFFAOYSA-N
MW211.32 g/mol
LogP1.76
Rot. Bonds3

About [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine

[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine (PubChem CID 130856141) has the molecular formula C8H9N3S2 and a molecular weight of 211.32 g/mol. Its IUPAC name is [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine.

Molecular Properties

Compound Name[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine
PubChem CID130856141
Molecular FormulaC8H9N3S2
Molecular Weight211.32 g/mol
Exact Mass211.02
IUPAC Name[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine
SMILESNNC(c1ccsc1)c1ccns1
InChIInChI=1S/C8H9N3S2/c9-11-8(6-2-4-12-5-6)7-1-3-10-13-7/h1-5,8,11H,9H2
InChIKeyIKIWTFYOMLLSAM-UHFFFAOYSA-N
XLogP1.76
TPSA50.94 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.32
LogP ≤ 51.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[pyrimidin-4-yl(thiophen-3-yl)methyl]hydrazine
CID 105220900
[quinoxalin-6-yl(thiophen-3-yl)methyl]hydrazine
CID 105221830
[(3-fluoro-2-pyridinyl)-thiophen-3-ylmethyl]hydrazine
CID 105257717
[(5-methylpyrimidin-2-yl)-thiophen-3-ylmethyl]hydrazine
CID 105261423
[(5-chloro-2-pyridinyl)-thiophen-3-ylmethyl]hydrazine
CID 105251361
[(5-bromo-2-pyridinyl)-thiophen-3-ylmethyl]hydrazine
CID 105267641
[(4-propylthiadiazol-5-yl)-thiophen-3-ylmethyl]hydrazine
CID 105311972
[thiophen-3-yl-(2,3,4-trifluorophenyl)methyl]hydrazine
CID 105196682
[thiophen-3-yl-[2-(trifluoromethyl)phenyl]methyl]hydrazine
CID 105196827
[isoquinolin-4-yl(thiophen-3-yl)methyl]hydrazine
CID 105196792
[(3-bromo-2-fluorophenyl)-thiophen-3-ylmethyl]hydrazine
CID 106648589
[[(1E)-cycloocten-1-yl]-thiophen-3-ylmethyl]hydrazine
CID 106648587

Frequently Asked Questions

What is the IUPAC name of [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine?
The IUPAC name of [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine (CID 130856141) is [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine.
What is the SMILES notation for [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine?
The canonical SMILES for [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine is NNC(c1ccsc1)c1ccns1.
What is the InChIKey of [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine?
The InChIKey is IKIWTFYOMLLSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S2/c9-11-8(6-2-4-12-5-6)7-1-3-10-13-7/h1-5,8,11H,9H2.
What are the key properties of [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine?
[1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine has a molecular weight of 211.32 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-thiazol-5-yl(thiophen-3-yl)methyl]hydrazine is sourced from PubChem (CID 130856141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).