C11H16ClNO — CID 130856161
5-(chloromethyl)-4-methyl-2-(1-methylcyclopentyl)-1,3-oxazole (PubChem CID 130856161) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 5-(chloromethyl)-4-methyl-2-(1-methylcyclopentyl)-1,3-oxazole.
| Compound Name | 5-(chloromethyl)-4-methyl-2-(1-methylcyclopentyl)-1,3-oxazole |
|---|---|
| PubChem CID | 130856161 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 5-(chloromethyl)-4-methyl-2-(1-methylcyclopentyl)-1,3-oxazole |
| SMILES | Cc1nc(C2(C)CCCC2)oc1CCl |
| InChI | InChI=1S/C11H16ClNO/c1-8-9(7-12)14-10(13-8)11(2)5-3-4-6-11/h3-7H2,1-2H3 |
| InChIKey | YJZPJFRHBGMPPW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|