C12H19NO — CID 141167685
4,5-dimethyl-2-(1-methylcyclohexyl)-1,3-oxazole (PubChem CID 141167685) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1-methylcyclohexyl)-1,3-oxazole.
| Compound Name | 4,5-dimethyl-2-(1-methylcyclohexyl)-1,3-oxazole |
|---|---|
| PubChem CID | 141167685 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4,5-dimethyl-2-(1-methylcyclohexyl)-1,3-oxazole |
| SMILES | Cc1nc(C2(C)CCCCC2)oc1C |
| InChI | InChI=1S/C12H19NO/c1-9-10(2)14-11(13-9)12(3)7-5-4-6-8-12/h4-8H2,1-3H3 |
| InChIKey | BDLVGEGBUVTCGT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |