C10H14N2O — CID 82410019
1-(4,5-dimethyl-1,3-oxazol-2-yl)cyclopent-3-en-1-amine (PubChem CID 82410019) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-oxazol-2-yl)cyclopent-3-en-1-amine.
| Compound Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)cyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 82410019 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-oxazol-2-yl)cyclopent-3-en-1-amine |
| SMILES | Cc1nc(C2(N)CC=CC2)oc1C |
| InChI | InChI=1S/C10H14N2O/c1-7-8(2)13-9(12-7)10(11)5-3-4-6-10/h3-4H,5-6,11H2,1-2H3 |
| InChIKey | KSLXRLFPHSNWMR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|