About 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine
1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine (PubChem CID 96637384) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine.
Analyze 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine?
The IUPAC name of 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine (CID 96637384) is 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine.
What is the SMILES notation for 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine?
The canonical SMILES for 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine is Cc1nonc1C1(N)CC1.
What is the InChIKey of 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine?
The InChIKey is GDQPZUBDGGMTSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-4-5(9-10-8-4)6(7)2-3-6/h2-3,7H2,1H3.
What are the key properties of 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine?
1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine has a molecular weight of 139.16 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,2,5-oxadiazol-3-yl)cyclopropan-1-amine is sourced from PubChem (CID 96637384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).