C9H14N4 — CID 55295876
5-(1-aminocyclopropyl)-2,6-dimethylpyrimidin-4-amine (PubChem CID 55295876) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-(1-aminocyclopropyl)-2,6-dimethylpyrimidin-4-amine.
| Compound Name | 5-(1-aminocyclopropyl)-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 55295876 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-(1-aminocyclopropyl)-2,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(C)c(C2(N)CC2)c(N)n1 |
| InChI | InChI=1S/C9H14N4/c1-5-7(9(11)3-4-9)8(10)13-6(2)12-5/h3-4,11H2,1-2H3,(H2,10,12,13) |
| InChIKey | CRSBEVCUBJWZPO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |