C8H13ClN2O3S — CID 130856195
2-chloro-N-(1-methylsulfonylpyrrolidin-3-yl)prop-2-enamide (PubChem CID 130856195) has the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. Its IUPAC name is 2-chloro-N-(1-methylsulfonylpyrrolidin-3-yl)prop-2-enamide.
| Compound Name | 2-chloro-N-(1-methylsulfonylpyrrolidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 130856195 |
| Molecular Formula | C8H13ClN2O3S |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-chloro-N-(1-methylsulfonylpyrrolidin-3-yl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)NC1CCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C8H13ClN2O3S/c1-6(9)8(12)10-7-3-4-11(5-7)15(2,13)14/h7H,1,3-5H2,2H3,(H,10,12) |
| InChIKey | AMHMCBILLWTIRS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|