C7H12N4 — CID 130856414
1-pent-4-en-2-yl-1,2,4-triazol-3-amine (PubChem CID 130856414) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-pent-4-en-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 1-pent-4-en-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130856414 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1-pent-4-en-2-yl-1,2,4-triazol-3-amine |
| SMILES | C=CCC(C)n1cnc(N)n1 |
| InChI | InChI=1S/C7H12N4/c1-3-4-6(2)11-5-9-7(8)10-11/h3,5-6H,1,4H2,2H3,(H2,8,10) |
| InChIKey | BRMNOJBDPGMVOU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|