C6H11N5 — CID 145221182
2-[(Z)-1-aminobut-1-en-2-yl]-1,2,4-triazol-3-amine (PubChem CID 145221182) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 2-[(Z)-1-aminobut-1-en-2-yl]-1,2,4-triazol-3-amine.
| Compound Name | 2-[(Z)-1-aminobut-1-en-2-yl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145221182 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 2-[(Z)-1-aminobut-1-en-2-yl]-1,2,4-triazol-3-amine |
| SMILES | CC/C(=C/N)n1ncnc1N |
| InChI | InChI=1S/C6H11N5/c1-2-5(3-7)11-6(8)9-4-10-11/h3-4H,2,7H2,1H3,(H2,8,9,10)/b5-3- |
| InChIKey | CYJJBYPYLJFMIM-HYXAFXHYSA-N |
| XLogP | 0.03 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |