C6H8N4 — CID 143935792
N-(2-prop-1-en-2-yl-1,2,4-triazol-3-yl)methanimine (PubChem CID 143935792) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is N-(2-prop-1-en-2-yl-1,2,4-triazol-3-yl)methanimine.
| Compound Name | N-(2-prop-1-en-2-yl-1,2,4-triazol-3-yl)methanimine |
|---|---|
| PubChem CID | 143935792 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | N-(2-prop-1-en-2-yl-1,2,4-triazol-3-yl)methanimine |
| SMILES | C=Nc1ncnn1C(=C)C |
| InChI | InChI=1S/C6H8N4/c1-5(2)10-6(7-3)8-4-9-10/h4H,1,3H2,2H3 |
| InChIKey | GYXUFKJKQKWAMR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|