C5H6FN3 — CID 177021723
5-fluoro-1-prop-1-en-2-yl-1,2,4-triazole (PubChem CID 177021723) has the molecular formula C5H6FN3 and a molecular weight of 127.12 g/mol. Its IUPAC name is 5-fluoro-1-prop-1-en-2-yl-1,2,4-triazole.
| Compound Name | 5-fluoro-1-prop-1-en-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 177021723 |
| Molecular Formula | C5H6FN3 |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 5-fluoro-1-prop-1-en-2-yl-1,2,4-triazole |
| SMILES | C=C(C)n1ncnc1F |
| InChI | InChI=1S/C5H6FN3/c1-4(2)9-5(6)7-3-8-9/h3H,1H2,2H3 |
| InChIKey | HVLNAYQYRRUVSQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |