About 1-but-2-en-2-yltetrazole
1-but-2-en-2-yltetrazole (PubChem CID 123381709) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 1-but-2-en-2-yltetrazole.
Molecular Properties
| Compound Name | 1-but-2-en-2-yltetrazole |
| PubChem CID | 123381709 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 1-but-2-en-2-yltetrazole |
| SMILES | CC=C(C)n1cnnn1 |
| InChI | InChI=1S/C5H8N4/c1-3-5(2)9-4-6-7-8-9/h3-4H,1-2H3 |
| InChIKey | QRVBWEYYODFXAA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-but-2-en-2-yltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-2-en-2-yltetrazole?
The IUPAC name of 1-but-2-en-2-yltetrazole (CID 123381709) is 1-but-2-en-2-yltetrazole.
What is the SMILES notation for 1-but-2-en-2-yltetrazole?
The canonical SMILES for 1-but-2-en-2-yltetrazole is CC=C(C)n1cnnn1.
What is the InChIKey of 1-but-2-en-2-yltetrazole?
The InChIKey is QRVBWEYYODFXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-3-5(2)9-4-6-7-8-9/h3-4H,1-2H3.
What are the key properties of 1-but-2-en-2-yltetrazole?
1-but-2-en-2-yltetrazole has a molecular weight of 124.15 g/mol, XLogP of 0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-en-2-yltetrazole is sourced from PubChem (CID 123381709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).