About 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole
1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole (PubChem CID 143038655) has the molecular formula C7H7ClN4
and a molecular weight of 182.61 g/mol. Its IUPAC name is 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole.
Molecular Properties
| Compound Name | 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole |
| PubChem CID | 143038655 |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole |
| SMILES | C=C(Cl)/C=C\C(=C)n1cnnn1 |
| InChI | InChI=1S/C7H7ClN4/c1-6(8)3-4-7(2)12-5-9-10-11-12/h3-5H,1-2H2/b4-3- |
| InChIKey | ZGLAAJQCJINSGP-ARJAWSKDSA-N |
| XLogP | 1.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole?
The IUPAC name of 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole (CID 143038655) is 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole.
What is the SMILES notation for 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole?
The canonical SMILES for 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole is C=C(Cl)/C=C\C(=C)n1cnnn1.
What is the InChIKey of 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole?
The InChIKey is ZGLAAJQCJINSGP-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H7ClN4/c1-6(8)3-4-7(2)12-5-9-10-11-12/h3-5H,1-2H2/b4-3-.
What are the key properties of 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole?
1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole has a molecular weight of 182.61 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]tetrazole is sourced from PubChem (CID 143038655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).