C10H17N4+ — CID 19365435
4,4-diethyl-5-methyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium (PubChem CID 19365435) has the molecular formula C10H17N4+ and a molecular weight of 193.27 g/mol. Its IUPAC name is 4,4-diethyl-5-methyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium.
| Compound Name | 4,4-diethyl-5-methyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 19365435 |
| Molecular Formula | C10H17N4+ |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.14 |
| IUPAC Name | 4,4-diethyl-5-methyl-7H-[1,2,4]triazolo[1,5-a]pyrimidin-4-ium |
| SMILES | CC[N+]1(CC)C(C)=CCn2ncnc21 |
| InChI | InChI=1S/C10H17N4/c1-4-14(5-2)9(3)6-7-13-10(14)11-8-12-13/h6,8H,4-5,7H2,1-3H3/q+1 |
| InChIKey | DFFYIYBBURNHDL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|