C12H20O2 — CID 130859602
(1S,3R,4S,5S)-4-(hydroxymethyl)-4-methyl-2-methylidene-1-propan-2-ylbicyclo[3.1.0]hexan-3-ol (PubChem CID 130859602) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1S,3R,4S,5S)-4-(hydroxymethyl)-4-methyl-2-methylidene-1-propan-2-ylbicyclo[3.1.0]hexan-3-ol.
| Compound Name | (1S,3R,4S,5S)-4-(hydroxymethyl)-4-methyl-2-methylidene-1-propan-2-ylbicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 130859602 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1S,3R,4S,5S)-4-(hydroxymethyl)-4-methyl-2-methylidene-1-propan-2-ylbicyclo[3.1.0]hexan-3-ol |
| SMILES | C=C1[C@@H](O)[C@](C)(CO)[C@H]2C[C@@]12C(C)C |
| InChI | InChI=1S/C12H20O2/c1-7(2)12-5-9(12)11(4,6-13)10(14)8(12)3/h7,9-10,13-14H,3,5-6H2,1-2,4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | CAWGIEMQJLFISC-DDHJBXDOSA-N |
| XLogP | 1.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|