About 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine
4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine (PubChem CID 130863604) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine |
| PubChem CID | 130863604 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine |
| SMILES | COC(C)CN1CC(Cl)C(C)(C)C1 |
| InChI | InChI=1S/C10H20ClNO/c1-8(13-4)5-12-6-9(11)10(2,3)7-12/h8-9H,5-7H2,1-4H3 |
| InChIKey | YOQWVUIHKIVSRG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine?
The IUPAC name of 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine (CID 130863604) is 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine.
What is the SMILES notation for 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine?
The canonical SMILES for 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine is COC(C)CN1CC(Cl)C(C)(C)C1.
What is the InChIKey of 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine?
The InChIKey is YOQWVUIHKIVSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO/c1-8(13-4)5-12-6-9(11)10(2,3)7-12/h8-9H,5-7H2,1-4H3.
What are the key properties of 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine?
4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine has a molecular weight of 205.73 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2-methoxypropyl)-3,3-dimethylpyrrolidine is sourced from PubChem (CID 130863604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).