C12H18ClNS — CID 130770092
4-chloro-3,3-dimethyl-1-[(5-methylthiophen-3-yl)methyl]pyrrolidine (PubChem CID 130770092) has the molecular formula C12H18ClNS and a molecular weight of 243.80 g/mol. Its IUPAC name is 4-chloro-3,3-dimethyl-1-[(5-methylthiophen-3-yl)methyl]pyrrolidine.
| Compound Name | 4-chloro-3,3-dimethyl-1-[(5-methylthiophen-3-yl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 130770092 |
| Molecular Formula | C12H18ClNS |
| Molecular Weight | 243.80 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-chloro-3,3-dimethyl-1-[(5-methylthiophen-3-yl)methyl]pyrrolidine |
| SMILES | Cc1cc(CN2CC(Cl)C(C)(C)C2)cs1 |
| InChI | InChI=1S/C12H18ClNS/c1-9-4-10(7-15-9)5-14-6-11(13)12(2,3)8-14/h4,7,11H,5-6,8H2,1-3H3 |
| InChIKey | LABOWASJZJDLQG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|