C9H6Cl2OS — CID 130865286
3,5-dichloro-4-methoxy-1-benzothiophene (PubChem CID 130865286) has the molecular formula C9H6Cl2OS and a molecular weight of 233.12 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-1-benzothiophene.
| Compound Name | 3,5-dichloro-4-methoxy-1-benzothiophene |
|---|---|
| PubChem CID | 130865286 |
| Molecular Formula | C9H6Cl2OS |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 3,5-dichloro-4-methoxy-1-benzothiophene |
| SMILES | COc1c(Cl)ccc2scc(Cl)c12 |
| InChI | InChI=1S/C9H6Cl2OS/c1-12-9-5(10)2-3-7-8(9)6(11)4-13-7/h2-4H,1H3 |
| InChIKey | UIBCIOVINLCMHW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |