C8H10ClN3O2 — CID 130865698
(2R)-2-amino-2-(3-amino-5-chloro-2-pyridinyl)propanoic acid (PubChem CID 130865698) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is (2R)-2-amino-2-(3-amino-5-chloro-2-pyridinyl)propanoic acid.
| Compound Name | (2R)-2-amino-2-(3-amino-5-chloro-2-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 130865698 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | (2R)-2-amino-2-(3-amino-5-chloro-2-pyridinyl)propanoic acid |
| SMILES | C[C@](N)(C(=O)O)c1ncc(Cl)cc1N |
| InChI | InChI=1S/C8H10ClN3O2/c1-8(11,7(13)14)6-5(10)2-4(9)3-12-6/h2-3H,10-11H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | ZWEMITWOMZELLB-MRVPVSSYSA-N |
| XLogP | 0.58 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |