C10H21N3 — CID 130870401
2-ethyl-N,N'-dimethylpiperidine-1-carboximidamide (PubChem CID 130870401) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-ethyl-N,N'-dimethylpiperidine-1-carboximidamide.
| Compound Name | 2-ethyl-N,N'-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 130870401 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-ethyl-N,N'-dimethylpiperidine-1-carboximidamide |
| SMILES | CCC1CCCCN1/C(=N/C)NC |
| InChI | InChI=1S/C10H21N3/c1-4-9-7-5-6-8-13(9)10(11-2)12-3/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | JURKZXZMTUNNFH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|