C10H17N3S — CID 130871154
2-(2,3,4-trimethylpyrrolidin-1-yl)-1,3-thiazol-5-amine (PubChem CID 130871154) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-(2,3,4-trimethylpyrrolidin-1-yl)-1,3-thiazol-5-amine.
| Compound Name | 2-(2,3,4-trimethylpyrrolidin-1-yl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 130871154 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(2,3,4-trimethylpyrrolidin-1-yl)-1,3-thiazol-5-amine |
| SMILES | CC1CN(c2ncc(N)s2)C(C)C1C |
| InChI | InChI=1S/C10H17N3S/c1-6-5-13(8(3)7(6)2)10-12-4-9(11)14-10/h4,6-8H,5,11H2,1-3H3 |
| InChIKey | PCQPALQIEQDOSN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |