C9H15NOS — CID 130874727
2-amino-3-(4,5-dimethylthiophen-2-yl)propan-1-ol (PubChem CID 130874727) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 2-amino-3-(4,5-dimethylthiophen-2-yl)propan-1-ol.
| Compound Name | 2-amino-3-(4,5-dimethylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 130874727 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-amino-3-(4,5-dimethylthiophen-2-yl)propan-1-ol |
| SMILES | Cc1cc(CC(N)CO)sc1C |
| InChI | InChI=1S/C9H15NOS/c1-6-3-9(12-7(6)2)4-8(10)5-11/h3,8,11H,4-5,10H2,1-2H3 |
| InChIKey | OXTGHCFPDIDHFK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |