C8H11NO3S — CID 130874794
2-(1,3-dioxolan-2-yl)-1-(1,2-thiazol-5-yl)ethanol (PubChem CID 130874794) has the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(1,2-thiazol-5-yl)ethanol.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130874794 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(1,2-thiazol-5-yl)ethanol |
| SMILES | OC(CC1OCCO1)c1ccns1 |
| InChI | InChI=1S/C8H11NO3S/c10-6(7-1-2-9-13-7)5-8-11-3-4-12-8/h1-2,6,8,10H,3-5H2 |
| InChIKey | BUOBNMKLFHHRSA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |