C9H13NO3S — CID 130802936
(3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanol (PubChem CID 130802936) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130802936 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (3-methoxyoxolan-3-yl)-(1,2-thiazol-5-yl)methanol |
| SMILES | COC1(C(O)c2ccns2)CCOC1 |
| InChI | InChI=1S/C9H13NO3S/c1-12-9(3-5-13-6-9)8(11)7-2-4-10-14-7/h2,4,8,11H,3,5-6H2,1H3 |
| InChIKey | GCYGSPUKMIFBCN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |