C9H13NOS — CID 130826273
cyclopentyl(1,2-thiazol-5-yl)methanol (PubChem CID 130826273) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is cyclopentyl(1,2-thiazol-5-yl)methanol.
| Compound Name | cyclopentyl(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130826273 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | cyclopentyl(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)C1CCCC1 |
| InChI | InChI=1S/C9H13NOS/c11-9(7-3-1-2-4-7)8-5-6-10-12-8/h5-7,9,11H,1-4H2 |
| InChIKey | JDWSPKBXFNWONR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |