C9H11F2NOS — CID 130826100
(3,3-difluorocyclopentyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 130826100) has the molecular formula C9H11F2NOS and a molecular weight of 219.26 g/mol. Its IUPAC name is (3,3-difluorocyclopentyl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (3,3-difluorocyclopentyl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130826100 |
| Molecular Formula | C9H11F2NOS |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (3,3-difluorocyclopentyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H11F2NOS/c10-9(11)3-1-6(5-9)8(13)7-2-4-12-14-7/h2,4,6,8,13H,1,3,5H2 |
| InChIKey | XNKLYOPGQNXEND-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |