C9H13NOS2 — CID 130871292
thian-3-yl(1,2-thiazol-5-yl)methanol (PubChem CID 130871292) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is thian-3-yl(1,2-thiazol-5-yl)methanol.
| Compound Name | thian-3-yl(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130871292 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | thian-3-yl(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)C1CCCSC1 |
| InChI | InChI=1S/C9H13NOS2/c11-9(8-3-4-10-13-8)7-2-1-5-12-6-7/h3-4,7,9,11H,1-2,5-6H2 |
| InChIKey | CIFXPWNWRSUROC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |