C11H17NOS — CID 130952207
cycloheptyl(1,2-thiazol-5-yl)methanol (PubChem CID 130952207) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is cycloheptyl(1,2-thiazol-5-yl)methanol.
| Compound Name | cycloheptyl(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130952207 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | cycloheptyl(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)C1CCCCCC1 |
| InChI | InChI=1S/C11H17NOS/c13-11(10-7-8-12-14-10)9-5-3-1-2-4-6-9/h7-9,11,13H,1-6H2 |
| InChIKey | PYQDUOJMTHBPDU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |