C10H15NOS2 — CID 130943557
2-(thian-4-yl)-1-(1,2-thiazol-5-yl)ethanol (PubChem CID 130943557) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-(thian-4-yl)-1-(1,2-thiazol-5-yl)ethanol.
| Compound Name | 2-(thian-4-yl)-1-(1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130943557 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(thian-4-yl)-1-(1,2-thiazol-5-yl)ethanol |
| SMILES | OC(CC1CCSCC1)c1ccns1 |
| InChI | InChI=1S/C10H15NOS2/c12-9(10-1-4-11-14-10)7-8-2-5-13-6-3-8/h1,4,8-9,12H,2-3,5-7H2 |
| InChIKey | WPEFRAHTLNOUDG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |