C11H17NOS — CID 130871296
(2,2-dimethylcyclopentyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 130871296) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (2,2-dimethylcyclopentyl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130871296 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | CC1(C)CCCC1C(O)c1ccns1 |
| InChI | InChI=1S/C11H17NOS/c1-11(2)6-3-4-8(11)10(13)9-5-7-12-14-9/h5,7-8,10,13H,3-4,6H2,1-2H3 |
| InChIKey | DDIRBZWHMCZPSV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |