C11H15NOS — CID 130855942
8-(1,2-thiazol-5-yl)spiro[3.4]octan-8-ol (PubChem CID 130855942) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 8-(1,2-thiazol-5-yl)spiro[3.4]octan-8-ol.
| Compound Name | 8-(1,2-thiazol-5-yl)spiro[3.4]octan-8-ol |
|---|---|
| PubChem CID | 130855942 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 8-(1,2-thiazol-5-yl)spiro[3.4]octan-8-ol |
| SMILES | OC1(c2ccns2)CCCC12CCC2 |
| InChI | InChI=1S/C11H15NOS/c13-11(9-3-8-12-14-9)7-2-6-10(11)4-1-5-10/h3,8,13H,1-2,4-7H2 |
| InChIKey | SNLCEJZZPZLRHC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |