C10H15NOS — CID 130942819
2-cyclopentyl-1-(1,2-thiazol-5-yl)ethanol (PubChem CID 130942819) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-cyclopentyl-1-(1,2-thiazol-5-yl)ethanol.
| Compound Name | 2-cyclopentyl-1-(1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130942819 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-cyclopentyl-1-(1,2-thiazol-5-yl)ethanol |
| SMILES | OC(CC1CCCC1)c1ccns1 |
| InChI | InChI=1S/C10H15NOS/c12-9(10-5-6-11-13-10)7-8-3-1-2-4-8/h5-6,8-9,12H,1-4,7H2 |
| InChIKey | SYJUJCPXGCWYCV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |