C8H11NOS — CID 130840886
3-(1,2-thiazol-5-yl)cyclopentan-1-ol (PubChem CID 130840886) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-(1,2-thiazol-5-yl)cyclopentan-1-ol.
| Compound Name | 3-(1,2-thiazol-5-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 130840886 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 3-(1,2-thiazol-5-yl)cyclopentan-1-ol |
| SMILES | OC1CCC(c2ccns2)C1 |
| InChI | InChI=1S/C8H11NOS/c10-7-2-1-6(5-7)8-3-4-9-11-8/h3-4,6-7,10H,1-2,5H2 |
| InChIKey | FXRJXIVSTQZWLN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |