C7H11NOS — CID 130900894
2-methyl-3-(1,2-thiazol-5-yl)propan-1-ol (PubChem CID 130900894) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 2-methyl-3-(1,2-thiazol-5-yl)propan-1-ol.
| Compound Name | 2-methyl-3-(1,2-thiazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 130900894 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-methyl-3-(1,2-thiazol-5-yl)propan-1-ol |
| SMILES | CC(CO)Cc1ccns1 |
| InChI | InChI=1S/C7H11NOS/c1-6(5-9)4-7-2-3-8-10-7/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | FMMFXGNWAFQCTD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |