C6H10N2OS — CID 55254258
2-amino-3-(1,2-thiazol-5-yl)propan-1-ol (PubChem CID 55254258) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-amino-3-(1,2-thiazol-5-yl)propan-1-ol.
| Compound Name | 2-amino-3-(1,2-thiazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 55254258 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-amino-3-(1,2-thiazol-5-yl)propan-1-ol |
| SMILES | NC(CO)Cc1ccns1 |
| InChI | InChI=1S/C6H10N2OS/c7-5(4-9)3-6-1-2-8-10-6/h1-2,5,9H,3-4,7H2 |
| InChIKey | ISIHSDDVFBINJF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |